C11H15BrF2 — CID 138668482
(2E,4E,6E)-5-bromo-1,1-difluoro-2-methyldeca-2,4,6-triene (PubChem CID 138668482) has the molecular formula C11H15BrF2 and a molecular weight of 265.14 g/mol. Its IUPAC name is (2E,4E,6E)-5-bromo-1,1-difluoro-2-methyldeca-2,4,6-triene.
| Compound Name | (2E,4E,6E)-5-bromo-1,1-difluoro-2-methyldeca-2,4,6-triene |
|---|---|
| PubChem CID | 138668482 |
| Molecular Formula | C11H15BrF2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (2E,4E,6E)-5-bromo-1,1-difluoro-2-methyldeca-2,4,6-triene |
| SMILES | CCC/C=C/C(Br)=C\C=C(/C)C(F)F |
| InChI | InChI=1S/C11H15BrF2/c1-3-4-5-6-10(12)8-7-9(2)11(13)14/h5-8,11H,3-4H2,1-2H3/b6-5+,9-7+,10-8+ |
| InChIKey | CHIPLDCUPULKGK-NRIIQWGUSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|