C17H28F2 — CID 145143761
(3E,5E,6Z)-5-(1,1-difluoro-3-methylpentan-2-ylidene)-4-methyldeca-3,6-diene (PubChem CID 145143761) has the molecular formula C17H28F2 and a molecular weight of 270.41 g/mol. Its IUPAC name is (3E,5E,6Z)-5-(1,1-difluoro-3-methylpentan-2-ylidene)-4-methyldeca-3,6-diene.
| Compound Name | (3E,5E,6Z)-5-(1,1-difluoro-3-methylpentan-2-ylidene)-4-methyldeca-3,6-diene |
|---|---|
| PubChem CID | 145143761 |
| Molecular Formula | C17H28F2 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3E,5E,6Z)-5-(1,1-difluoro-3-methylpentan-2-ylidene)-4-methyldeca-3,6-diene |
| SMILES | CC/C=C(C)/C(/C=C\CCC)=C(/C(F)F)C(C)CC |
| InChI | InChI=1S/C17H28F2/c1-6-9-10-12-15(14(5)11-7-2)16(17(18)19)13(4)8-3/h10-13,17H,6-9H2,1-5H3/b12-10-,14-11+,16-15+ |
| InChIKey | RIMRZUCZZTYROZ-HOELLYNKSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|