C15H25N — CID 145143647
N-[(2Z,4Z)-3-[(E)-pent-2-en-2-yl]octa-2,4-dien-2-yl]ethanimine (PubChem CID 145143647) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-[(E)-pent-2-en-2-yl]octa-2,4-dien-2-yl]ethanimine.
| Compound Name | N-[(2Z,4Z)-3-[(E)-pent-2-en-2-yl]octa-2,4-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 145143647 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[(2Z,4Z)-3-[(E)-pent-2-en-2-yl]octa-2,4-dien-2-yl]ethanimine |
| SMILES | C/C=N/C(C)=C(/C=C\CCC)C(\C)=C\CC |
| InChI | InChI=1S/C15H25N/c1-6-9-10-12-15(13(4)11-7-2)14(5)16-8-3/h8,10-12H,6-7,9H2,1-5H3/b12-10-,13-11+,15-14-,16-8+ |
| InChIKey | FSYXWRHRZVIXQE-RMWNGUNFSA-N |
| XLogP | 5.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|