C17H28N2O — CID 177143066
N-[(1E,3Z)-1-piperidin-4-yloxy-2-prop-1-en-2-ylhepta-1,3-dienyl]ethanimine (PubChem CID 177143066) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-[(1E,3Z)-1-piperidin-4-yloxy-2-prop-1-en-2-ylhepta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E,3Z)-1-piperidin-4-yloxy-2-prop-1-en-2-ylhepta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 177143066 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-[(1E,3Z)-1-piperidin-4-yloxy-2-prop-1-en-2-ylhepta-1,3-dienyl]ethanimine |
| SMILES | C=C(C)C(/C=C\CCC)=C(\N=CC)OC1CCNCC1 |
| InChI | InChI=1S/C17H28N2O/c1-5-7-8-9-16(14(3)4)17(19-6-2)20-15-10-12-18-13-11-15/h6,8-9,15,18H,3,5,7,10-13H2,1-2,4H3/b9-8-,17-16+,19-6? |
| InChIKey | AHVZSESFBWJDDN-OOCJQEHYSA-N |
| XLogP | 3.99 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|