C15H24O — CID 176941862
[(3Z,5Z)-3-methylnona-1,3,5-trien-2-yl]oxycyclopentane (PubChem CID 176941862) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [(3Z,5Z)-3-methylnona-1,3,5-trien-2-yl]oxycyclopentane.
| Compound Name | [(3Z,5Z)-3-methylnona-1,3,5-trien-2-yl]oxycyclopentane |
|---|---|
| PubChem CID | 176941862 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(3Z,5Z)-3-methylnona-1,3,5-trien-2-yl]oxycyclopentane |
| SMILES | C=C(OC1CCCC1)/C(C)=C\C=C/CCC |
| InChI | InChI=1S/C15H24O/c1-4-5-6-7-10-13(2)14(3)16-15-11-8-9-12-15/h6-7,10,15H,3-5,8-9,11-12H2,1-2H3/b7-6-,13-10- |
| InChIKey | BXZZUZGGDQPXGJ-IAHOLQHESA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|