C15H27N — CID 126707036
(1Z,3E)-1-cycloheptyl-N-methylhepta-1,3-dien-1-amine (PubChem CID 126707036) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (1Z,3E)-1-cycloheptyl-N-methylhepta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-cycloheptyl-N-methylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 126707036 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (1Z,3E)-1-cycloheptyl-N-methylhepta-1,3-dien-1-amine |
| SMILES | CCC/C=C/C=C(\NC)C1CCCCCC1 |
| InChI | InChI=1S/C15H27N/c1-3-4-5-10-13-15(16-2)14-11-8-6-7-9-12-14/h5,10,13-14,16H,3-4,6-9,11-12H2,1-2H3/b10-5+,15-13- |
| InChIKey | NBQUFCXQHGLLGJ-MMMBZVNJSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|