C17H17Cl2F2NO3S — CID 177238820
4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;ethyl formate (PubChem CID 177238820) has the molecular formula C17H17Cl2F2NO3S and a molecular weight of 424.30 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;ethyl formate.
| Compound Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;ethyl formate |
|---|---|
| PubChem CID | 177238820 |
| Molecular Formula | C17H17Cl2F2NO3S |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;ethyl formate |
| SMILES | CCOC=O.Cc1c(Sc2c(Cl)cccc2Cl)cc(C(C)(F)F)[nH]c1=O |
| InChI | InChI=1S/C14H11Cl2F2NOS.C3H6O2/c1-7-10(6-11(14(2,17)18)19-13(7)20)21-12-8(15)4-3-5-9(12)16;1-2-5-3-4/h3-6H,1-2H3,(H,19,20);3H,2H2,1H3 |
| InChIKey | KWAALDSHCQIIBD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|