C14H16N4O2 — CID 177240385
3-[(1,5-dimethylindazol-3-yl)amino]piperidine-2,6-dione (PubChem CID 177240385) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[(1,5-dimethylindazol-3-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(1,5-dimethylindazol-3-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240385 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[(1,5-dimethylindazol-3-yl)amino]piperidine-2,6-dione |
| SMILES | Cc1ccc2c(c1)c(NC1CCC(=O)NC1=O)nn2C |
| InChI | InChI=1S/C14H16N4O2/c1-8-3-5-11-9(7-8)13(17-18(11)2)15-10-4-6-12(19)16-14(10)20/h3,5,7,10H,4,6H2,1-2H3,(H,15,17)(H,16,19,20) |
| InChIKey | FAADBPPIMRFGGN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|