C13H14N4O2 — CID 171103569
3-[(4-methylpyrazolo[1,5-a]pyridin-7-yl)amino]piperidine-2,6-dione (PubChem CID 171103569) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-[(4-methylpyrazolo[1,5-a]pyridin-7-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(4-methylpyrazolo[1,5-a]pyridin-7-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171103569 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-[(4-methylpyrazolo[1,5-a]pyridin-7-yl)amino]piperidine-2,6-dione |
| SMILES | Cc1ccc(NC2CCC(=O)NC2=O)n2nccc12 |
| InChI | InChI=1S/C13H14N4O2/c1-8-2-4-11(17-10(8)6-7-14-17)15-9-3-5-12(18)16-13(9)19/h2,4,6-7,9,15H,3,5H2,1H3,(H,16,18,19) |
| InChIKey | FYUMWXXOKJPWOV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|