C11H18N4O2 — CID 114277259
3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]piperidine-2,6-dione (PubChem CID 114277259) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 114277259 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]piperidine-2,6-dione |
| SMILES | CC1(C)CN=C(NC2CCC(=O)NC2=O)NC1 |
| InChI | InChI=1S/C11H18N4O2/c1-11(2)5-12-10(13-6-11)14-7-3-4-8(16)15-9(7)17/h7H,3-6H2,1-2H3,(H2,12,13,14)(H,15,16,17) |
| InChIKey | REVPEPUYJPPPCC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|