C21H26N6O2 — CID 163343231
3-[[2-(3-methylphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]piperidine-2,6-dione (PubChem CID 163343231) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-[[2-(3-methylphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[2-(3-methylphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163343231 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-[[2-(3-methylphenyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]piperidine-2,6-dione |
| SMILES | Cc1cccc(-c2nc(NC3CCC(=O)NC3=O)cc(N3CCN(C)CC3)n2)c1 |
| InChI | InChI=1S/C21H26N6O2/c1-14-4-3-5-15(12-14)20-23-17(22-16-6-7-19(28)25-21(16)29)13-18(24-20)27-10-8-26(2)9-11-27/h3-5,12-13,16H,6-11H2,1-2H3,(H,22,23,24)(H,25,28,29) |
| InChIKey | RBLLLLXSBGZJQQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|