C19H23F3IN3O2 — CID 177240869
tert-butyl N-tert-butyl-N-[4-[2-iodo-3-(trifluoromethyl)imidazol-4-yl]phenyl]carbamate (PubChem CID 177240869) has the molecular formula C19H23F3IN3O2 and a molecular weight of 509.31 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[4-[2-iodo-3-(trifluoromethyl)imidazol-4-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[4-[2-iodo-3-(trifluoromethyl)imidazol-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 177240869 |
| Molecular Formula | C19H23F3IN3O2 |
| Molecular Weight | 509.31 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[4-[2-iodo-3-(trifluoromethyl)imidazol-4-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(-c2cnc(I)n2C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H23F3IN3O2/c1-17(2,3)25(16(27)28-18(4,5)6)13-9-7-12(8-10-13)14-11-24-15(23)26(14)19(20,21)22/h7-11H,1-6H3 |
| InChIKey | PEEHALJDABQZQI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|