C36H41F2NO3 — CID 177241142
2-[[7-[(E)-1-(4,4-difluoropent-1-yn-3-ylideneamino)-2-phenylprop-1-enyl]-4-oxo-1H-naphthalen-2-yl]methyl]-8-methylcyclooctane-1,5-dione;ethane;molecular hydrogen (PubChem CID 177241142) has the molecular formula C36H41F2NO3 and a molecular weight of 573.72 g/mol. Its IUPAC name is 2-[[7-[(E)-1-(4,4-difluoropent-1-yn-3-ylideneamino)-2-phenylprop-1-enyl]-4-oxo-1H-naphthalen-2-yl]methyl]-8-methylcyclooctane-1,5-dione;ethane;molecular hydrogen.
| Compound Name | 2-[[7-[(E)-1-(4,4-difluoropent-1-yn-3-ylideneamino)-2-phenylprop-1-enyl]-4-oxo-1H-naphthalen-2-yl]methyl]-8-methylcyclooctane-1,5-dione;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 177241142 |
| Molecular Formula | C36H41F2NO3 |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2-[[7-[(E)-1-(4,4-difluoropent-1-yn-3-ylideneamino)-2-phenylprop-1-enyl]-4-oxo-1H-naphthalen-2-yl]methyl]-8-methylcyclooctane-1,5-dione;ethane;molecular hydrogen |
| SMILES | C#C/C(=N\C(=C(/C)c1ccccc1)c1ccc2c(c1)CC(CC1CCC(=O)CCC(C)C1=O)=CC2=O)C(C)(F)F.CC.[H][H] |
| InChI | InChI=1S/C34H33F2NO3.C2H6.H2/c1-5-31(34(4,35)36)37-32(22(3)24-9-7-6-8-10-24)25-13-16-29-27(20-25)18-23(19-30(29)39)17-26-12-15-28(38)14-11-21(2)33(26)40;1-2;/h1,6-10,13,16,19-21,26H,11-12,14-15,17-18H2,2-4H3;1-2H3;1H/b32-22+,37-31+;; |
| InChIKey | AFSGLGPCYLAGCO-QTQMKVAYSA-N |
| XLogP | 8.60 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|