C32H47F2NO — CID 177241189
acetylene;ethane;1-[2-ethyl-4-[(Z)-1-[[(Z,4E)-4-ethylidene-8,8-difluoro-2-methylnon-5-en-3-ylidene]amino]prop-1-enyl]phenyl]-2-methylbutan-1-one (PubChem CID 177241189) has the molecular formula C32H47F2NO and a molecular weight of 499.73 g/mol. Its IUPAC name is acetylene;ethane;1-[2-ethyl-4-[(Z)-1-[[(Z,4E)-4-ethylidene-8,8-difluoro-2-methylnon-5-en-3-ylidene]amino]prop-1-enyl]phenyl]-2-methylbutan-1-one.
| Compound Name | acetylene;ethane;1-[2-ethyl-4-[(Z)-1-[[(Z,4E)-4-ethylidene-8,8-difluoro-2-methylnon-5-en-3-ylidene]amino]prop-1-enyl]phenyl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 177241189 |
| Molecular Formula | C32H47F2NO |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.36 |
| IUPAC Name | acetylene;ethane;1-[2-ethyl-4-[(Z)-1-[[(Z,4E)-4-ethylidene-8,8-difluoro-2-methylnon-5-en-3-ylidene]amino]prop-1-enyl]phenyl]-2-methylbutan-1-one |
| SMILES | C#C.C/C=C(\N=C(C(/C=C\CC(C)(F)F)=C/C)\C(C)C)c1ccc(C(=O)C(C)CC)c(CC)c1.CC |
| InChI | InChI=1S/C28H39F2NO.C2H6.C2H2/c1-9-20(7)27(32)24-16-15-23(18-22(24)11-3)25(12-4)31-26(19(5)6)21(10-2)14-13-17-28(8,29)30;2*1-2/h10,12-16,18-20H,9,11,17H2,1-8H3;1-2H3;1-2H/b14-13-,21-10+,25-12-,31-26+;; |
| InChIKey | GAIPVGIUQCWVBB-OSWOJXPNSA-N |
| XLogP | 9.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|