C32H32O2 — CID 177242466
4,6-ditert-butyl-2,8-diphenyldibenzofuran-1-ol (PubChem CID 177242466) has the molecular formula C32H32O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 4,6-ditert-butyl-2,8-diphenyldibenzofuran-1-ol.
| Compound Name | 4,6-ditert-butyl-2,8-diphenyldibenzofuran-1-ol |
|---|---|
| PubChem CID | 177242466 |
| Molecular Formula | C32H32O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4,6-ditert-butyl-2,8-diphenyldibenzofuran-1-ol |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc2c1oc1c(C(C)(C)C)cc(-c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C32H32O2/c1-31(2,3)25-18-22(20-13-9-7-10-14-20)17-24-27-28(33)23(21-15-11-8-12-16-21)19-26(32(4,5)6)30(27)34-29(24)25/h7-19,33H,1-6H3 |
| InChIKey | HIXATTVDTRESCN-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |