C51H49N3O — CID 177242681
2-phenyl-4-(3-phenylphenyl)-6-[4-(4,6,8-tritert-butyldibenzofuran-2-yl)phenyl]-1,3,5-triazine (PubChem CID 177242681) has the molecular formula C51H49N3O and a molecular weight of 719.97 g/mol. Its IUPAC name is 2-phenyl-4-(3-phenylphenyl)-6-[4-(4,6,8-tritert-butyldibenzofuran-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(3-phenylphenyl)-6-[4-(4,6,8-tritert-butyldibenzofuran-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 177242681 |
| Molecular Formula | C51H49N3O |
| Molecular Weight | 719.97 g/mol |
| Exact Mass | 719.39 |
| IUPAC Name | 2-phenyl-4-(3-phenylphenyl)-6-[4-(4,6,8-tritert-butyldibenzofuran-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3c(C(C)(C)C)cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7ccccc7)c6)n5)cc4)cc3c2c1 |
| InChI | InChI=1S/C51H49N3O/c1-49(2,3)39-30-41-40-28-38(29-42(50(4,5)6)44(40)55-45(41)43(31-39)51(7,8)9)33-23-25-35(26-24-33)47-52-46(34-19-14-11-15-20-34)53-48(54-47)37-22-16-21-36(27-37)32-17-12-10-13-18-32/h10-31H,1-9H3 |
| InChIKey | XXVJMENQPYITTQ-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.97 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |