C44H44N2O — CID 177242586
4-phenyl-2-[3-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]quinazoline (PubChem CID 177242586) has the molecular formula C44H44N2O and a molecular weight of 616.85 g/mol. Its IUPAC name is 4-phenyl-2-[3-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]quinazoline.
| Compound Name | 4-phenyl-2-[3-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]quinazoline |
|---|---|
| PubChem CID | 177242586 |
| Molecular Formula | C44H44N2O |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | 4-phenyl-2-[3-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]quinazoline |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3nc(-c4ccccc4)c4ccccc4n3)c2)c2oc3c(C(C)(C)C)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C44H44N2O/c1-42(2,3)30-23-33(39-34(24-30)35-25-31(43(4,5)6)26-36(40(35)47-39)44(7,8)9)28-18-15-19-29(22-28)41-45-37-21-14-13-20-32(37)38(46-41)27-16-11-10-12-17-27/h10-26H,1-9H3 |
| InChIKey | GDGQMQDWHBLVFG-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |