C35H33N3O — CID 177242649
2-(4,8-ditert-butyldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 177242649) has the molecular formula C35H33N3O and a molecular weight of 511.67 g/mol. Its IUPAC name is 2-(4,8-ditert-butyldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(4,8-ditert-butyldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177242649 |
| Molecular Formula | C35H33N3O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2-(4,8-ditert-butyldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc2oc3c(C(C)(C)C)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c2c1 |
| InChI | InChI=1S/C35H33N3O/c1-34(2,3)24-17-20-28-27(21-24)25-18-19-26(29(30(25)39-28)35(4,5)6)33-37-31(22-13-9-7-10-14-22)36-32(38-33)23-15-11-8-12-16-23/h7-21H,1-6H3 |
| InChIKey | ILAXDCCTQZYHSK-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |