C11H22N2 — CID 177243767
1,5-diethyl-3,4-dimethylpyrazole;ethane (PubChem CID 177243767) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,5-diethyl-3,4-dimethylpyrazole;ethane.
| Compound Name | 1,5-diethyl-3,4-dimethylpyrazole;ethane |
|---|---|
| PubChem CID | 177243767 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,5-diethyl-3,4-dimethylpyrazole;ethane |
| SMILES | CC.CCc1c(C)c(C)nn1CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-5-9-7(3)8(4)10-11(9)6-2;1-2/h5-6H2,1-4H3;1-2H3 |
| InChIKey | VPTKNEJEYRCAEM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |