About 1,5-diethyl-3,4-dimethylpyrazole;ethane
1,5-diethyl-3,4-dimethylpyrazole;ethane (PubChem CID 177243767) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,5-diethyl-3,4-dimethylpyrazole;ethane.
Molecular Properties
| Compound Name | 1,5-diethyl-3,4-dimethylpyrazole;ethane |
| PubChem CID | 177243767 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,5-diethyl-3,4-dimethylpyrazole;ethane |
| SMILES | CC.CCc1c(C)c(C)nn1CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-5-9-7(3)8(4)10-11(9)6-2;1-2/h5-6H2,1-4H3;1-2H3 |
| InChIKey | VPTKNEJEYRCAEM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-diethyl-3,4-dimethylpyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diethyl-3,4-dimethylpyrazole;ethane?
The IUPAC name of 1,5-diethyl-3,4-dimethylpyrazole;ethane (CID 177243767) is 1,5-diethyl-3,4-dimethylpyrazole;ethane.
What is the SMILES notation for 1,5-diethyl-3,4-dimethylpyrazole;ethane?
The canonical SMILES for 1,5-diethyl-3,4-dimethylpyrazole;ethane is CC.CCc1c(C)c(C)nn1CC.
What is the InChIKey of 1,5-diethyl-3,4-dimethylpyrazole;ethane?
The InChIKey is VPTKNEJEYRCAEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.C2H6/c1-5-9-7(3)8(4)10-11(9)6-2;1-2/h5-6H2,1-4H3;1-2H3.
What are the key properties of 1,5-diethyl-3,4-dimethylpyrazole;ethane?
1,5-diethyl-3,4-dimethylpyrazole;ethane has a molecular weight of 182.31 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethyl-3,4-dimethylpyrazole;ethane is sourced from PubChem (CID 177243767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).