About [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium
[[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium (PubChem CID 177246585) has the molecular formula C6H14N3Re-
and a molecular weight of 314.41 g/mol. Its IUPAC name is [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium.
Molecular Properties
| Compound Name | [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium |
| PubChem CID | 177246585 |
| Molecular Formula | C6H14N3Re- |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium |
| SMILES | CC(N)/C=C\C(C)N[NH-].[Re] |
| InChI | InChI=1S/C6H14N3.Re/c1-5(7)3-4-6(2)9-8;/h3-6,8-9H,7H2,1-2H3;/q-1;/b4-3-; |
| InChIKey | TUJOMSPIFHTKNC-LNKPDPKZSA-N |
| XLogP | 0.83 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium?
The IUPAC name of [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium (CID 177246585) is [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium.
What is the SMILES notation for [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium?
The canonical SMILES for [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium is CC(N)/C=C\C(C)N[NH-].[Re].
What is the InChIKey of [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium?
The InChIKey is TUJOMSPIFHTKNC-LNKPDPKZSA-N. The full InChI is InChI=1S/C6H14N3.Re/c1-5(7)3-4-6(2)9-8;/h3-6,8-9H,7H2,1-2H3;/q-1;/b4-3-;.
What are the key properties of [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium?
[[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium has a molecular weight of 314.41 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(Z)-5-aminohex-3-en-2-yl]amino]azanide;rhenium is sourced from PubChem (CID 177246585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).