C23H12Cl2F6N4O — CID 177249614
N-(2,6-dichloro-3-pyridinyl)-1,2-bis[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide (PubChem CID 177249614) has the molecular formula C23H12Cl2F6N4O and a molecular weight of 545.27 g/mol. Its IUPAC name is N-(2,6-dichloro-3-pyridinyl)-1,2-bis[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide.
| Compound Name | N-(2,6-dichloro-3-pyridinyl)-1,2-bis[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 177249614 |
| Molecular Formula | C23H12Cl2F6N4O |
| Molecular Weight | 545.27 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | N-(2,6-dichloro-3-pyridinyl)-1,2-bis[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1Cl)c1cn(Cc2cc(F)c(F)c(F)c2)c(Cc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C23H12Cl2F6N4O/c24-18-2-1-16(22(25)34-18)33-23(36)17-9-35(8-11-5-14(28)21(31)15(29)6-11)19(32-17)7-10-3-12(26)20(30)13(27)4-10/h1-6,9H,7-8H2,(H,33,36) |
| InChIKey | UWGYZRZFELMCQG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.27 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|