C23H26N6O6 — CID 177252652
1-(2-nitrophenyl)ethyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-phenyl-1H-1,2,4,5-tetrazine-2-carboxylate (PubChem CID 177252652) has the molecular formula C23H26N6O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-(2-nitrophenyl)ethyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-phenyl-1H-1,2,4,5-tetrazine-2-carboxylate.
| Compound Name | 1-(2-nitrophenyl)ethyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-phenyl-1H-1,2,4,5-tetrazine-2-carboxylate |
|---|---|
| PubChem CID | 177252652 |
| Molecular Formula | C23H26N6O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-(2-nitrophenyl)ethyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-phenyl-1H-1,2,4,5-tetrazine-2-carboxylate |
| SMILES | CC(OC(=O)N1NC(c2ccccc2)=NN=C1CNC(=O)OC(C)(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N6O6/c1-15(17-12-8-9-13-18(17)29(32)33)34-22(31)28-19(14-24-21(30)35-23(2,3)4)25-26-20(27-28)16-10-6-5-7-11-16/h5-13,15H,14H2,1-4H3,(H,24,30)(H,26,27) |
| InChIKey | YEZKOFSMMKYITE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|