C30H30N2O7 — CID 177253321
diethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanedioate (PubChem CID 177253321) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is diethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanedioate.
| Compound Name | diethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanedioate |
|---|---|
| PubChem CID | 177253321 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | diethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanedioate |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)c1c(C)c2cc(OC)ccc2n1-c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O7/c1-5-38-28(34)30(36,29(35)39-6-2)26-19(3)22-18-21(37-4)16-17-24(22)32(26)25-15-11-10-14-23(25)31-27(33)20-12-8-7-9-13-20/h7-18,36H,5-6H2,1-4H3,(H,31,33) |
| InChIKey | CUBIOZXZVAAMRM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|