C28H28N2O5 — CID 177253310
ethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanoate (PubChem CID 177253310) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is ethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanoate.
| Compound Name | ethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 177253310 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | ethyl 2-[1-(2-benzamidophenyl)-5-methoxy-3-methylindol-2-yl]-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(C)(O)c1c(C)c2cc(OC)ccc2n1-c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O5/c1-5-35-27(32)28(3,33)25-18(2)21-17-20(34-4)15-16-23(21)30(25)24-14-10-9-13-22(24)29-26(31)19-11-7-6-8-12-19/h6-17,33H,5H2,1-4H3,(H,29,31) |
| InChIKey | CEZDGRHCAURYLY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |