C34H30N2O6 — CID 177253351
diethyl 2-[1-(2-benzamidophenyl)-3-phenylindol-2-yl]-2-hydroxypropanedioate (PubChem CID 177253351) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is diethyl 2-[1-(2-benzamidophenyl)-3-phenylindol-2-yl]-2-hydroxypropanedioate.
| Compound Name | diethyl 2-[1-(2-benzamidophenyl)-3-phenylindol-2-yl]-2-hydroxypropanedioate |
|---|---|
| PubChem CID | 177253351 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | diethyl 2-[1-(2-benzamidophenyl)-3-phenylindol-2-yl]-2-hydroxypropanedioate |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)c1c(-c2ccccc2)c2ccccc2n1-c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H30N2O6/c1-3-41-32(38)34(40,33(39)42-4-2)30-29(23-15-7-5-8-16-23)25-19-11-13-21-27(25)36(30)28-22-14-12-20-26(28)35-31(37)24-17-9-6-10-18-24/h5-22,40H,3-4H2,1-2H3,(H,35,37) |
| InChIKey | KPHVHMUDUROPQN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|