C20H29N3O4 — CID 177253611
[2-[(4-formyl-2-pyridinyl)amino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate (PubChem CID 177253611) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-[(4-formyl-2-pyridinyl)amino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate.
| Compound Name | [2-[(4-formyl-2-pyridinyl)amino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 177253611 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [2-[(4-formyl-2-pyridinyl)amino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate |
| SMILES | CC1CCC(C(OC(=O)NC(C)(C)C)C(=O)Nc2cc(C=O)ccn2)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-13-5-7-15(8-6-13)17(27-19(26)23-20(2,3)4)18(25)22-16-11-14(12-24)9-10-21-16/h9-13,15,17H,5-8H2,1-4H3,(H,23,26)(H,21,22,25) |
| InChIKey | FWPKITYLGNPTTF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|