C6H12N2O3S — CID 177254702
2-methyl-1-methylsulfonylazetidine-3-carboxamide (PubChem CID 177254702) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonylazetidine-3-carboxamide.
| Compound Name | 2-methyl-1-methylsulfonylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 177254702 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-methyl-1-methylsulfonylazetidine-3-carboxamide |
| SMILES | CC1C(C(N)=O)CN1S(C)(=O)=O |
| InChI | InChI=1S/C6H12N2O3S/c1-4-5(6(7)9)3-8(4)12(2,10)11/h4-5H,3H2,1-2H3,(H2,7,9) |
| InChIKey | ZUPFSRLEYSXEBV-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |