C28H39NO2 — CID 177254778
1-amino-3-hydroxy-4,6,6a,8a,11,14a-hexamethyl-1,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one (PubChem CID 177254778) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is 1-amino-3-hydroxy-4,6,6a,8a,11,14a-hexamethyl-1,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one.
| Compound Name | 1-amino-3-hydroxy-4,6,6a,8a,11,14a-hexamethyl-1,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one |
|---|---|
| PubChem CID | 177254778 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | 1-amino-3-hydroxy-4,6,6a,8a,11,14a-hexamethyl-1,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one |
| SMILES | CC1=CC2=C(C(N)C(=O)C(O)=C2C)C2(C)CCC3=C(CCC4(C)CCC(C)CC34)C12C |
| InChI | InChI=1S/C28H39NO2/c1-15-7-10-26(4)11-9-20-18(21(26)13-15)8-12-27(5)22-19(14-16(2)28(20,27)6)17(3)24(30)25(31)23(22)29/h14-15,21,23,30H,7-13,29H2,1-6H3 |
| InChIKey | FPJOHRLJZJZTTK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|