C28H39NO2 — CID 146648439
(6bR,8aR,11S,12aS,14aR)-12a-amino-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,11,12,13,14-octahydropicen-2-one (PubChem CID 146648439) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is (6bR,8aR,11S,12aS,14aR)-12a-amino-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,11,12,13,14-octahydropicen-2-one.
| Compound Name | (6bR,8aR,11S,12aS,14aR)-12a-amino-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,11,12,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 146648439 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (6bR,8aR,11S,12aS,14aR)-12a-amino-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,11,12,13,14-octahydropicen-2-one |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CCC2(C)[C@]3(N)C[C@@H](C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C28H39NO2/c1-17-9-10-24(3)11-13-26(5)22-8-7-19-18(2)23(31)21(30)15-20(19)25(22,4)12-14-27(26,6)28(24,29)16-17/h7-8,15,17,31H,9-14,16,29H2,1-6H3/t17-,24+,25-,26+,27?,28-/m0/s1 |
| InChIKey | DEIOEKFRQKGDGP-HFDUPYCESA-N |
| XLogP | 6.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |