C36H26O11S2 — CID 177259712
2-[2-(4-methylsulfonylphenyl)acetyl]-5-[2-[2-(4-methylsulfonylphenyl)acetyl]-1,3-dioxoinden-5-yl]oxyindene-1,3-dione (PubChem CID 177259712) has the molecular formula C36H26O11S2 and a molecular weight of 698.73 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonylphenyl)acetyl]-5-[2-[2-(4-methylsulfonylphenyl)acetyl]-1,3-dioxoinden-5-yl]oxyindene-1,3-dione.
| Compound Name | 2-[2-(4-methylsulfonylphenyl)acetyl]-5-[2-[2-(4-methylsulfonylphenyl)acetyl]-1,3-dioxoinden-5-yl]oxyindene-1,3-dione |
|---|---|
| PubChem CID | 177259712 |
| Molecular Formula | C36H26O11S2 |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.09 |
| IUPAC Name | 2-[2-(4-methylsulfonylphenyl)acetyl]-5-[2-[2-(4-methylsulfonylphenyl)acetyl]-1,3-dioxoinden-5-yl]oxyindene-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)C2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)C(C(=O)Cc4ccc(S(C)(=O)=O)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C36H26O11S2/c1-48(43,44)23-9-3-19(4-10-23)15-29(37)31-33(39)25-13-7-21(17-27(25)35(31)41)47-22-8-14-26-28(18-22)36(42)32(34(26)40)30(38)16-20-5-11-24(12-6-20)49(2,45)46/h3-14,17-18,31-32H,15-16H2,1-2H3 |
| InChIKey | ILVMEFITNJXSNR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 179.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|