C14H21F2N — CID 177260449
2,3-ditert-butyl-5-(difluoromethyl)pyridine (PubChem CID 177260449) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is 2,3-ditert-butyl-5-(difluoromethyl)pyridine.
| Compound Name | 2,3-ditert-butyl-5-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 177260449 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2,3-ditert-butyl-5-(difluoromethyl)pyridine |
| SMILES | CC(C)(C)c1cc(C(F)F)cnc1C(C)(C)C |
| InChI | InChI=1S/C14H21F2N/c1-13(2,3)10-7-9(12(15)16)8-17-11(10)14(4,5)6/h7-8,12H,1-6H3 |
| InChIKey | GWIKMJKQJJVBEU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |