C12H16N4 — CID 177263002
6-tert-butyl-8-methylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 177263002) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 6-tert-butyl-8-methylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-8-methylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 177263002 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 6-tert-butyl-8-methylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cc(C(C)(C)C)nc2c(N)ncnc12 |
| InChI | InChI=1S/C12H16N4/c1-7-5-8(12(2,3)4)16-10-9(7)14-6-15-11(10)13/h5-6H,1-4H3,(H2,13,14,15) |
| InChIKey | NLEJBXNDBJJLMD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |