C23H42O10P2 — CID 177263417
2-[1-[2-(5-methyl-3-phenylheptoxy)ethoxy]-3-(2-phosphonoethoxy)propan-2-yl]oxyethylphosphonic acid (PubChem CID 177263417) has the molecular formula C23H42O10P2 and a molecular weight of 540.53 g/mol. Its IUPAC name is 2-[1-[2-(5-methyl-3-phenylheptoxy)ethoxy]-3-(2-phosphonoethoxy)propan-2-yl]oxyethylphosphonic acid.
| Compound Name | 2-[1-[2-(5-methyl-3-phenylheptoxy)ethoxy]-3-(2-phosphonoethoxy)propan-2-yl]oxyethylphosphonic acid |
|---|---|
| PubChem CID | 177263417 |
| Molecular Formula | C23H42O10P2 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[1-[2-(5-methyl-3-phenylheptoxy)ethoxy]-3-(2-phosphonoethoxy)propan-2-yl]oxyethylphosphonic acid |
| SMILES | CCC(C)CC(CCOCCOCC(COCCP(=O)(O)O)OCCP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C23H42O10P2/c1-3-20(2)17-22(21-7-5-4-6-8-21)9-10-30-11-12-31-18-23(33-14-16-35(27,28)29)19-32-13-15-34(24,25)26/h4-8,20,22-23H,3,9-19H2,1-2H3,(H2,24,25,26)(H2,27,28,29) |
| InChIKey | AMNVKKJOLMFDTG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|