C51H82O8Si2 — CID 140862922
3-[6-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-10-methyl-4,8-diphenyl-1-(3-triethoxysilylpropoxy)dodecan-2-yl]oxypropyl-triethoxysilane (PubChem CID 140862922) has the molecular formula C51H82O8Si2 and a molecular weight of 879.38 g/mol. Its IUPAC name is 3-[6-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-10-methyl-4,8-diphenyl-1-(3-triethoxysilylpropoxy)dodecan-2-yl]oxypropyl-triethoxysilane.
| Compound Name | 3-[6-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-10-methyl-4,8-diphenyl-1-(3-triethoxysilylpropoxy)dodecan-2-yl]oxypropyl-triethoxysilane |
|---|---|
| PubChem CID | 140862922 |
| Molecular Formula | C51H82O8Si2 |
| Molecular Weight | 879.38 g/mol |
| Exact Mass | 878.55 |
| IUPAC Name | 3-[6-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-10-methyl-4,8-diphenyl-1-(3-triethoxysilylpropoxy)dodecan-2-yl]oxypropyl-triethoxysilane |
| SMILES | CCO[Si](CCCOCC(CC(CC(CC(CC(C)CC)c1ccccc1)c1ccc2c(c1)CC2)c1ccccc1)OCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C51H82O8Si2/c1-9-42(8)36-48(43-24-18-16-19-25-43)38-49(47-31-29-45-28-30-46(45)37-47)39-50(44-26-20-17-21-27-44)40-51(53-33-23-35-61(57-13-5,58-14-6)59-15-7)41-52-32-22-34-60(54-10-2,55-11-3)56-12-4/h16-21,24-27,29,31,37,42,48-51H,9-15,22-23,28,30,32-36,38-41H2,1-8H3 |
| InChIKey | PZKOFJQHRLYUCR-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.38 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|