C18H15IO6S — CID 177265965
4-[2-(3H-indene-5-carbonyloxy)ethoxy]-2-iodobenzenesulfonic acid (PubChem CID 177265965) has the molecular formula C18H15IO6S and a molecular weight of 486.28 g/mol. Its IUPAC name is 4-[2-(3H-indene-5-carbonyloxy)ethoxy]-2-iodobenzenesulfonic acid.
| Compound Name | 4-[2-(3H-indene-5-carbonyloxy)ethoxy]-2-iodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177265965 |
| Molecular Formula | C18H15IO6S |
| Molecular Weight | 486.28 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | 4-[2-(3H-indene-5-carbonyloxy)ethoxy]-2-iodobenzenesulfonic acid |
| SMILES | O=C(OCCOc1ccc(S(=O)(=O)O)c(I)c1)c1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C18H15IO6S/c19-16-11-15(6-7-17(16)26(21,22)23)24-8-9-25-18(20)14-5-4-12-2-1-3-13(12)10-14/h1-2,4-7,10-11H,3,8-9H2,(H,21,22,23) |
| InChIKey | QLVXHOTVLXAGLW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|