C14H13Cl2FN4O — CID 177267548
(1R,7S,8R)-2-(2,7-dichloro-8-methylpyrido[4,3-d]pyrimidin-4-yl)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane (PubChem CID 177267548) has the molecular formula C14H13Cl2FN4O and a molecular weight of 343.19 g/mol. Its IUPAC name is (1R,7S,8R)-2-(2,7-dichloro-8-methylpyrido[4,3-d]pyrimidin-4-yl)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane.
| Compound Name | (1R,7S,8R)-2-(2,7-dichloro-8-methylpyrido[4,3-d]pyrimidin-4-yl)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 177267548 |
| Molecular Formula | C14H13Cl2FN4O |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (1R,7S,8R)-2-(2,7-dichloro-8-methylpyrido[4,3-d]pyrimidin-4-yl)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane |
| SMILES | Cc1c(Cl)ncc2c(N3CCOC[C@H]4[C@@H](F)[C@@H]43)nc(Cl)nc12 |
| InChI | InChI=1S/C14H13Cl2FN4O/c1-6-10-7(4-18-12(6)15)13(20-14(16)19-10)21-2-3-22-5-8-9(17)11(8)21/h4,8-9,11H,2-3,5H2,1H3/t8-,9+,11+/m0/s1 |
| InChIKey | AVXCZXQFSXZIMX-IQJOONFLSA-N |
| XLogP | 2.81 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|