C23H21F2N3O4 — CID 177267722
2,6-difluoro-4-[2-(5-isocyano-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)ethoxy]benzoic acid (PubChem CID 177267722) has the molecular formula C23H21F2N3O4 and a molecular weight of 441.43 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-(5-isocyano-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)ethoxy]benzoic acid.
| Compound Name | 2,6-difluoro-4-[2-(5-isocyano-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 177267722 |
| Molecular Formula | C23H21F2N3O4 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2,6-difluoro-4-[2-(5-isocyano-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)ethoxy]benzoic acid |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(CCN(CCOc3cc(F)c(C(=O)O)c(F)c3)CC1)C(=O)N2C |
| InChI | InChI=1S/C23H21F2N3O4/c1-26-14-3-4-19-16(11-14)23(22(31)27(19)2)5-7-28(8-6-23)9-10-32-15-12-17(24)20(21(29)30)18(25)13-15/h3-4,11-13H,5-10H2,2H3,(H,29,30) |
| InChIKey | HSDQBBGKZZPTHB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|