C14H34O4Si3 — CID 177268731
trimethyl-[methyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]-trimethylsilyloxysilyl]oxysilane (PubChem CID 177268731) has the molecular formula C14H34O4Si3 and a molecular weight of 350.68 g/mol. Its IUPAC name is trimethyl-[methyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[methyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 177268731 |
| Molecular Formula | C14H34O4Si3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | trimethyl-[methyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]-trimethylsilyloxysilyl]oxysilane |
| SMILES | CC1(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C14H34O4Si3/c1-14(13-16-14)12-15-10-9-11-21(8,17-19(2,3)4)18-20(5,6)7/h9-13H2,1-8H3 |
| InChIKey | NPSBQHRYGWCQDE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|