C10H13N4O10P — CID 177270425
[(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(2,6,8-trioxo-3,7-dihydropurin-9-yl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 177270425) has the molecular formula C10H13N4O10P and a molecular weight of 380.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(2,6,8-trioxo-3,7-dihydropurin-9-yl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(2,6,8-trioxo-3,7-dihydropurin-9-yl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177270425 |
| Molecular Formula | C10H13N4O10P |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | [(2R,3S,4R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(2,6,8-trioxo-3,7-dihydropurin-9-yl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)n([C@@H]3O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H13N4O10P/c15-1-2-5(24-25(20,21)22)4(16)8(23-2)14-6-3(11-10(14)19)7(17)13-9(18)12-6/h2,4-5,8,15-16H,1H2,(H,11,19)(H2,20,21,22)(H2,12,13,17,18)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | VKTPPKWHSTUZHH-UMMCILCDSA-N |
| XLogP | -3.57 |
| TPSA | 219.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|