C13H19NO — CID 177282872
4,6-di(propan-2-yl)-6,7-dihydrofuro[3,2-c]pyridine (PubChem CID 177282872) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-6,7-dihydrofuro[3,2-c]pyridine.
| Compound Name | 4,6-di(propan-2-yl)-6,7-dihydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 177282872 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4,6-di(propan-2-yl)-6,7-dihydrofuro[3,2-c]pyridine |
| SMILES | CC(C)C1=NC(C(C)C)Cc2occc21 |
| InChI | InChI=1S/C13H19NO/c1-8(2)11-7-12-10(5-6-15-12)13(14-11)9(3)4/h5-6,8-9,11H,7H2,1-4H3 |
| InChIKey | IOJGNRDTJOPKFO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |