C25H34F3N7O3 — CID 177284352
[4-[(6-morpholin-4-yl-3-pyridinyl)amino]-5-(oxan-4-yl)pyrimidin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate (PubChem CID 177284352) has the molecular formula C25H34F3N7O3 and a molecular weight of 537.59 g/mol. Its IUPAC name is [4-[(6-morpholin-4-yl-3-pyridinyl)amino]-5-(oxan-4-yl)pyrimidin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate.
| Compound Name | [4-[(6-morpholin-4-yl-3-pyridinyl)amino]-5-(oxan-4-yl)pyrimidin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate |
|---|---|
| PubChem CID | 177284352 |
| Molecular Formula | C25H34F3N7O3 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [4-[(6-morpholin-4-yl-3-pyridinyl)amino]-5-(oxan-4-yl)pyrimidin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate |
| SMILES | [H]/N=C(/OCc1ncc(C2CCOCC2)c(Nc2ccc(N3CCOCC3)nc2)n1)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C25H34F3N7O3/c1-17(2)35(16-25(26,27)28)24(29)38-15-21-30-14-20(18-5-9-36-10-6-18)23(33-21)32-19-3-4-22(31-13-19)34-7-11-37-12-8-34/h3-4,13-14,17-18,29H,5-12,15-16H2,1-2H3,(H,30,32,33)/b29-24+ |
| InChIKey | KEYAZVYASXRNEN-RMLRFSFXSA-N |
| XLogP | 4.07 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|