C25H32F3N7O3 — CID 177284339
[5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl N-ethyl-N-(2,2,2-trifluoroethyl)carbamimidate (PubChem CID 177284339) has the molecular formula C25H32F3N7O3 and a molecular weight of 535.57 g/mol. Its IUPAC name is [5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl N-ethyl-N-(2,2,2-trifluoroethyl)carbamimidate.
| Compound Name | [5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl N-ethyl-N-(2,2,2-trifluoroethyl)carbamimidate |
|---|---|
| PubChem CID | 177284339 |
| Molecular Formula | C25H32F3N7O3 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | [5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl N-ethyl-N-(2,2,2-trifluoroethyl)carbamimidate |
| SMILES | [H]/N=C(/OCc1nc(NC)c2c(n1)N(c1ccc(N3CCOCC3)cc1)C(=O)C2(C)C)N(CC)CC(F)(F)F |
| InChI | InChI=1S/C25H32F3N7O3/c1-5-33(15-25(26,27)28)23(29)38-14-18-31-20(30-4)19-21(32-18)35(22(36)24(19,2)3)17-8-6-16(7-9-17)34-10-12-37-13-11-34/h6-9,29H,5,10-15H2,1-4H3,(H,30,31,32)/b29-23+ |
| InChIKey | IWCVLXJZCHYKRV-BYNJWEBRSA-N |
| XLogP | 3.65 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|