C27H34F3N7O3 — CID 177284419
[(1S)-1-[5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]ethyl] (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate (PubChem CID 177284419) has the molecular formula C27H34F3N7O3 and a molecular weight of 561.61 g/mol. Its IUPAC name is [(1S)-1-[5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]ethyl] (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate.
| Compound Name | [(1S)-1-[5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]ethyl] (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate |
|---|---|
| PubChem CID | 177284419 |
| Molecular Formula | C27H34F3N7O3 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | [(1S)-1-[5,5-dimethyl-4-(methylamino)-7-(4-morpholin-4-ylphenyl)-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]ethyl] (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate |
| SMILES | [H]/N=C(/O[C@@H](C)c1nc(NC)c2c(n1)N(c1ccc(N3CCOCC3)cc1)C(=O)C2(C)C)N1CCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C27H34F3N7O3/c1-16(40-25(31)36-11-5-6-19(36)27(28,29)30)21-33-22(32-4)20-23(34-21)37(24(38)26(20,2)3)18-9-7-17(8-10-18)35-12-14-39-15-13-35/h7-10,16,19,31H,5-6,11-15H2,1-4H3,(H,32,33,34)/b31-25+/t16-,19+/m0/s1 |
| InChIKey | TVOSYWJXWQGMED-RKGMSGIBSA-N |
| XLogP | 4.35 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|