C28H35F6N7O3 — CID 177284421
[7-(2-methoxy-4-morpholin-4-ylphenyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)-6H-pyrrolo[2,3-d]pyrimidin-2-yl]methyl (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate (PubChem CID 177284421) has the molecular formula C28H35F6N7O3 and a molecular weight of 631.62 g/mol. Its IUPAC name is [7-(2-methoxy-4-morpholin-4-ylphenyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)-6H-pyrrolo[2,3-d]pyrimidin-2-yl]methyl (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate.
| Compound Name | [7-(2-methoxy-4-morpholin-4-ylphenyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)-6H-pyrrolo[2,3-d]pyrimidin-2-yl]methyl (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate |
|---|---|
| PubChem CID | 177284421 |
| Molecular Formula | C28H35F6N7O3 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | [7-(2-methoxy-4-morpholin-4-ylphenyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)-6H-pyrrolo[2,3-d]pyrimidin-2-yl]methyl (2R)-2-(trifluoromethyl)pyrrolidine-1-carboximidate |
| SMILES | [H]/N=C(/OCc1nc(NCC(F)(F)F)c2c(n1)N(c1ccc(N3CCOCC3)cc1OC)CC2(C)C)N1CCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C28H35F6N7O3/c1-26(2)16-41(18-7-6-17(13-19(18)42-3)39-9-11-43-12-10-39)24-22(26)23(36-15-27(29,30)31)37-21(38-24)14-44-25(35)40-8-4-5-20(40)28(32,33)34/h6-7,13,20,35H,4-5,8-12,14-16H2,1-3H3,(H,36,37,38)/b35-25+/t20-/m1/s1 |
| InChIKey | IOPJEXNCQUKHDR-LVPPHWLSSA-N |
| XLogP | 5.20 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|