C25H30F4N8O3 — CID 177284796
[4-amino-7-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5,5-dimethyl-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl 3,3,4,4-tetrafluoropyrrolidine-1-carboximidate (PubChem CID 177284796) has the molecular formula C25H30F4N8O3 and a molecular weight of 566.56 g/mol. Its IUPAC name is [4-amino-7-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5,5-dimethyl-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl 3,3,4,4-tetrafluoropyrrolidine-1-carboximidate.
| Compound Name | [4-amino-7-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5,5-dimethyl-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl 3,3,4,4-tetrafluoropyrrolidine-1-carboximidate |
|---|---|
| PubChem CID | 177284796 |
| Molecular Formula | C25H30F4N8O3 |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | [4-amino-7-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-5,5-dimethyl-6-oxopyrrolo[2,3-d]pyrimidin-2-yl]methyl 3,3,4,4-tetrafluoropyrrolidine-1-carboximidate |
| SMILES | [H]/N=C(/OCc1nc(N)c2c(n1)N(c1ccc(N3C[C@@H](C)O[C@@H](C)C3)nc1)C(=O)C2(C)C)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C25H30F4N8O3/c1-13-8-35(9-14(2)40-13)17-6-5-15(7-32-17)37-20-18(23(3,4)21(37)38)19(30)33-16(34-20)10-39-22(31)36-11-24(26,27)25(28,29)12-36/h5-7,13-14,31H,8-12H2,1-4H3,(H2,30,33,34)/b31-22+/t13-,14+ |
| InChIKey | FHZQBKCUSSAARK-KHSWHAKVSA-N |
| XLogP | 3.06 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|