C14H28O — CID 177285058
trans-(1S,2S)-1-tert-butyl-2-[2-(2,2-dimethylpropoxy)ethyl]cyclopropane (PubChem CID 177285058) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is trans-(1S,2S)-1-tert-butyl-2-[2-(2,2-dimethylpropoxy)ethyl]cyclopropane.
| Compound Name | trans-(1S,2S)-1-tert-butyl-2-[2-(2,2-dimethylpropoxy)ethyl]cyclopropane |
|---|---|
| PubChem CID | 177285058 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | trans-(1S,2S)-1-tert-butyl-2-[2-(2,2-dimethylpropoxy)ethyl]cyclopropane |
| SMILES | CC(C)(C)COCC[C@@H]1C[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-13(2,3)10-15-8-7-11-9-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3/t11-,12+/m1/s1 |
| InChIKey | VQMSDTMIQFAFTA-NEPJUHHUSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|