C43H46IrN4OSi-2 — CID 177294840
CID 177294840 (PubChem CID 177294840) has the molecular formula C43H46IrN4OSi-2 and a molecular weight of 855.17 g/mol.
| Compound Name | CID 177294840 |
|---|---|
| PubChem CID | 177294840 |
| Molecular Formula | C43H46IrN4OSi-2 |
| Molecular Weight | 855.17 g/mol |
| Exact Mass | 855.31 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1C(C)(C)C.C[Si](C)(C)c1ccnc(-c2[c-]ccc3c2oc2c3ccc3nc4n(c32)CCCC4)c1.[Ir] |
| InChI | InChI=1S/C25H24N3OSi.C18H22N.Ir/c1-30(2,3)16-12-13-26-21(15-16)19-8-6-7-17-18-10-11-20-23(25(18)29-24(17)19)28-14-5-4-9-22(28)27-20;1-13(2)15-11-17(14-9-7-6-8-10-14)19-12-16(15)18(3,4)5;/h6-7,10-13,15H,4-5,9,14H2,1-3H3;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | PNDIRDHHYZFTFT-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.17 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|