C35H28IrN4O-2 — CID 177294929
CID 177294929 (PubChem CID 177294929) has the molecular formula C35H28IrN4O-2 and a molecular weight of 712.85 g/mol.
| Compound Name | CID 177294929 |
|---|---|
| PubChem CID | 177294929 |
| Molecular Formula | C35H28IrN4O-2 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | — |
| SMILES | Cc1cnc(-c2[c-]ccc3c2oc2c3ccc3nc4n(c32)CCCC4)cc1C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C24H20N3O.C11H8N.Ir/c1-14-12-20(25-13-15(14)2)18-7-5-6-16-17-9-10-19-22(24(17)28-23(16)18)27-11-4-3-8-21(27)26-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-6,9-10,12-13H,3-4,8,11H2,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | VAPCHOXQHXBBHP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|