C28H39N5O4 — CID 177301922
3-[2-oxo-5-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]methyl]spiro[indole-3,4'-oxane]-1-yl]piperidine-2,6-dione (PubChem CID 177301922) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 3-[2-oxo-5-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]methyl]spiro[indole-3,4'-oxane]-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-5-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]methyl]spiro[indole-3,4'-oxane]-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177301922 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 3-[2-oxo-5-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]methyl]spiro[indole-3,4'-oxane]-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)C3(CCOCC3)c3cc(CN4CCN(CC5CCNCC5)CC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C28H39N5O4/c34-25-4-3-24(26(35)30-25)33-23-2-1-21(17-22(23)28(27(33)36)7-15-37-16-8-28)19-32-13-11-31(12-14-32)18-20-5-9-29-10-6-20/h1-2,17,20,24,29H,3-16,18-19H2,(H,30,34,35) |
| InChIKey | SYPHPDKOFMSWDK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|