C26H48N4O7S — CID 177312253
5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[2-[3-(2-amino-2-oxoethoxy)propoxy]ethoxy]-7-ethoxyheptyl]pentanamide (PubChem CID 177312253) has the molecular formula C26H48N4O7S and a molecular weight of 560.76 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[2-[3-(2-amino-2-oxoethoxy)propoxy]ethoxy]-7-ethoxyheptyl]pentanamide.
| Compound Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[2-[3-(2-amino-2-oxoethoxy)propoxy]ethoxy]-7-ethoxyheptyl]pentanamide |
|---|---|
| PubChem CID | 177312253 |
| Molecular Formula | C26H48N4O7S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[2-[3-(2-amino-2-oxoethoxy)propoxy]ethoxy]-7-ethoxyheptyl]pentanamide |
| SMILES | CCOCC(CCCCCNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21)OCCOCCCOCC(N)=O |
| InChI | InChI=1S/C26H48N4O7S/c1-2-34-17-20(37-16-15-35-13-8-14-36-18-23(27)31)9-4-3-7-12-28-24(32)11-6-5-10-22-25-21(19-38-22)29-26(33)30-25/h20-22,25H,2-19H2,1H3,(H2,27,31)(H,28,32)(H2,29,30,33)/t20?,21-,22-,25-/m1/s1 |
| InChIKey | ZHRWXAGCMAZGJD-YEZMSPLHSA-N |
| XLogP | 1.72 |
| TPSA | 150.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|